C9H8N4OS2 — CID 708835
2-pyrimidin-2-ylsulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 708835) has the molecular formula C9H8N4OS2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-pyrimidin-2-ylsulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-pyrimidin-2-ylsulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 708835 |
| Molecular Formula | C9H8N4OS2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 2-pyrimidin-2-ylsulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1ncccn1)Nc1nccs1 |
| InChI | InChI=1S/C9H8N4OS2/c14-7(13-9-12-4-5-15-9)6-16-8-10-2-1-3-11-8/h1-5H,6H2,(H,12,13,14) |
| InChIKey | XBACVHMHPJDMAW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |