C27H23ClF4N8O3 — CID 70883553
methyl 16-(3-chloro-4-fluoroanilino)-9-(2-morpholin-4-ylethylamino)-4-(trifluoromethyl)-2,3,8,15,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene-10-carboxylate (PubChem CID 70883553) has the molecular formula C27H23ClF4N8O3 and a molecular weight of 618.98 g/mol. Its IUPAC name is methyl 16-(3-chloro-4-fluoroanilino)-9-(2-morpholin-4-ylethylamino)-4-(trifluoromethyl)-2,3,8,15,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene-10-carboxylate.
| Compound Name | methyl 16-(3-chloro-4-fluoroanilino)-9-(2-morpholin-4-ylethylamino)-4-(trifluoromethyl)-2,3,8,15,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene-10-carboxylate |
|---|---|
| PubChem CID | 70883553 |
| Molecular Formula | C27H23ClF4N8O3 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | methyl 16-(3-chloro-4-fluoroanilino)-9-(2-morpholin-4-ylethylamino)-4-(trifluoromethyl)-2,3,8,15,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,7,9,11,13,15-octaene-10-carboxylate |
| SMILES | COC(=O)c1cc2c3cnc(Nc4ccc(F)c(Cl)c4)nc3n3nc(C(F)(F)F)cc3c2nc1NCCN1CCOCC1 |
| InChI | InChI=1S/C27H23ClF4N8O3/c1-42-25(41)16-11-15-17-13-34-26(35-14-2-3-19(29)18(28)10-14)37-24(17)40-20(12-21(38-40)27(30,31)32)22(15)36-23(16)33-4-5-39-6-8-43-9-7-39/h2-3,10-13H,4-9H2,1H3,(H,33,36)(H,34,35,37) |
| InChIKey | HZLBANAYJCGYJQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|