C23H27FO4S — CID 70884236
(2R,3R,4S,5S,6S)-2-[7-[(4-ethylphenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 70884236) has the molecular formula C23H27FO4S and a molecular weight of 418.53 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-[7-[(4-ethylphenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-[7-[(4-ethylphenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70884236 |
| Molecular Formula | C23H27FO4S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-[7-[(4-ethylphenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cccc3c2SC([C@@H]2O[C@H](CF)[C@@H](O)[C@H](O)[C@H]2O)C3)cc1 |
| InChI | InChI=1S/C23H27FO4S/c1-2-13-6-8-14(9-7-13)10-15-4-3-5-16-11-18(29-23(15)16)22-21(27)20(26)19(25)17(12-24)28-22/h3-9,17-22,25-27H,2,10-12H2,1H3/t17-,18?,19-,20+,21-,22+/m1/s1 |
| InChIKey | FBXHQEITRVUVAH-GLEIMRJVSA-N |
| XLogP | 2.68 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |