C21H23FO5S — CID 70884288
(2R,3R,4S,5S,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70884288) has the molecular formula C21H23FO5S and a molecular weight of 406.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70884288 |
| Molecular Formula | C21H23FO5S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](C2Cc3cccc(Cc4ccc(F)cc4)c3S2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H23FO5S/c22-14-6-4-11(5-7-14)8-12-2-1-3-13-9-16(28-21(12)13)20-19(26)18(25)17(24)15(10-23)27-20/h1-7,15-20,23-26H,8-10H2/t15-,16?,17-,18+,19-,20+/m1/s1 |
| InChIKey | GLSUGBARCZZNJU-DXDKGHSRSA-N |
| XLogP | 1.28 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |