About 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol
1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol (PubChem CID 70885356) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol |
| PubChem CID | 70885356 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol |
| SMILES | COc1ccc(-c2nc(C(C)O)oc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-12(21)19-20-17(13-4-8-15(22-2)9-5-13)18(24-19)14-6-10-16(23-3)11-7-14/h4-12,21H,1-3H3 |
| InChIKey | ATVSDQGCICWLOU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol?
The IUPAC name of 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol (CID 70885356) is 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol.
What is the SMILES notation for 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol?
The canonical SMILES for 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol is COc1ccc(-c2nc(C(C)O)oc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol?
The InChIKey is ATVSDQGCICWLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-12(21)19-20-17(13-4-8-15(22-2)9-5-13)18(24-19)14-6-10-16(23-3)11-7-14/h4-12,21H,1-3H3.
What are the key properties of 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol?
1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol has a molecular weight of 325.36 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]ethanol is sourced from PubChem (CID 70885356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).