C31H31NO — CID 70885667
5-(4-methoxyphenyl)-8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),18-octaene (PubChem CID 70885667) has the molecular formula C31H31NO and a molecular weight of 433.60 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),18-octaene.
| Compound Name | 5-(4-methoxyphenyl)-8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),18-octaene |
|---|---|
| PubChem CID | 70885667 |
| Molecular Formula | C31H31NO |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 5-(4-methoxyphenyl)-8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),18-octaene |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)(C)c2cccc4c2N3C2=C(CCC=C2)C4(C)C)cc1 |
| InChI | InChI=1S/C31H31NO/c1-30(2)23-9-6-7-12-27(23)32-28-18-15-21(20-13-16-22(33-5)17-14-20)19-26(28)31(3,4)25-11-8-10-24(30)29(25)32/h7-8,10-19H,6,9H2,1-5H3 |
| InChIKey | NLIZNTNEVJGYCY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |