C19H20N4O — CID 70886973
1-(1H-indol-4-yl)-3-(1,2,3,4-tetrahydroquinolin-2-ylmethyl)urea (PubChem CID 70886973) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-3-(1,2,3,4-tetrahydroquinolin-2-ylmethyl)urea.
| Compound Name | 1-(1H-indol-4-yl)-3-(1,2,3,4-tetrahydroquinolin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 70886973 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-(1H-indol-4-yl)-3-(1,2,3,4-tetrahydroquinolin-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCc2ccccc2N1)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C19H20N4O/c24-19(23-18-7-3-6-17-15(18)10-11-20-17)21-12-14-9-8-13-4-1-2-5-16(13)22-14/h1-7,10-11,14,20,22H,8-9,12H2,(H2,21,23,24) |
| InChIKey | ZDEPWEMZZLBUKW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |