C22H21F2N5O — CID 70887001
1-[6-(2,4-difluorophenyl)-2-pyridinyl]-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea (PubChem CID 70887001) has the molecular formula C22H21F2N5O and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-[6-(2,4-difluorophenyl)-2-pyridinyl]-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea.
| Compound Name | 1-[6-(2,4-difluorophenyl)-2-pyridinyl]-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 70887001 |
| Molecular Formula | C22H21F2N5O |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[6-(2,4-difluorophenyl)-2-pyridinyl]-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccc2c(n1)NCCC2)Nc1cccc(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C22H21F2N5O/c23-15-7-9-17(18(24)13-15)19-4-1-5-20(28-19)29-22(30)26-12-10-16-8-6-14-3-2-11-25-21(14)27-16/h1,4-9,13H,2-3,10-12H2,(H,25,27)(H2,26,28,29,30) |
| InChIKey | NRQQWZNOBSKSSF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |