C17H28O5 — CID 70887250
(8S,9R,10S,11S)-4-ethyl-8,10-dihydroxy-3,7,11-trimethyl-5-oxabicyclo[7.3.1]tridecane-2,6-dione (PubChem CID 70887250) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (8S,9R,10S,11S)-4-ethyl-8,10-dihydroxy-3,7,11-trimethyl-5-oxabicyclo[7.3.1]tridecane-2,6-dione.
| Compound Name | (8S,9R,10S,11S)-4-ethyl-8,10-dihydroxy-3,7,11-trimethyl-5-oxabicyclo[7.3.1]tridecane-2,6-dione |
|---|---|
| PubChem CID | 70887250 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (8S,9R,10S,11S)-4-ethyl-8,10-dihydroxy-3,7,11-trimethyl-5-oxabicyclo[7.3.1]tridecane-2,6-dione |
| SMILES | CCC1OC(=O)C(C)[C@@H](O)[C@@H]2CC(C[C@H](C)[C@@H]2O)C(=O)C1C |
| InChI | InChI=1S/C17H28O5/c1-5-13-9(3)15(19)11-6-8(2)14(18)12(7-11)16(20)10(4)17(21)22-13/h8-14,16,18,20H,5-7H2,1-4H3/t8-,9?,10?,11?,12+,13?,14-,16+/m0/s1 |
| InChIKey | QLTQIVHYDRUIFB-JAJVTTPYSA-N |
| XLogP | 1.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |