C42H33N4O2P2+ — CID 70887268
2-[3-(2-hydroxy-1,3-diphenyl-1,3,2-benzodiazaphosphol-2-ium-2-yl)phenyl]-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 70887268) has the molecular formula C42H33N4O2P2+ and a molecular weight of 687.70 g/mol. Its IUPAC name is 2-[3-(2-hydroxy-1,3-diphenyl-1,3,2-benzodiazaphosphol-2-ium-2-yl)phenyl]-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 2-[3-(2-hydroxy-1,3-diphenyl-1,3,2-benzodiazaphosphol-2-ium-2-yl)phenyl]-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 70887268 |
| Molecular Formula | C42H33N4O2P2+ |
| Molecular Weight | 687.70 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | 2-[3-(2-hydroxy-1,3-diphenyl-1,3,2-benzodiazaphosphol-2-ium-2-yl)phenyl]-1,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | O=P1(c2cccc([P+]3(O)N(c4ccccc4)c4ccccc4N3c3ccccc3)c2)N(c2ccccc2)c2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C42H33N4O2P2/c47-49(43(33-18-5-1-6-19-33)39-28-13-14-29-40(39)44(49)34-20-7-2-8-21-34)37-26-17-27-38(32-37)50(48)45(35-22-9-3-10-23-35)41-30-15-16-31-42(41)46(50)36-24-11-4-12-25-36/h1-32,47H/q+1 |
| InChIKey | PMUWJEFWMYBYCA-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.70 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|