C52H72N2 — CID 70887289
CID 70887289 (PubChem CID 70887289) has the molecular formula C52H72N2 and a molecular weight of 725.16 g/mol.
| Compound Name | CID 70887289 |
|---|---|
| PubChem CID | 70887289 |
| Molecular Formula | C52H72N2 |
| Molecular Weight | 725.16 g/mol |
| Exact Mass | 724.57 |
| IUPAC Name | — |
| SMILES | CCCCCC1CC2(C3=C1C=CCC3)C1=C(CCC(NC3CC=CCC3[C@@H]3C=C(N)CCC3)C1)C1(C3=CC=CCC3C3CCCCC31)C1CC=CC(C)C12 |
| InChI | InChI=1S/C52H72N2/c1-3-4-5-17-36-33-51(43-24-10-6-20-39(36)43)48-32-38(54-49-28-13-9-21-40(49)35-18-15-19-37(53)31-35)29-30-46(48)52(47-27-14-16-34(2)50(47)51)44-25-11-7-22-41(44)42-23-8-12-26-45(42)52/h6-7,9,11,13-14,16,20,25,31,34-36,38,40-42,45,47,49-50,54H,3-5,8,10,12,15,17-19,21-24,26-30,32-33,53H2,1-2H3/t34?,35-,36?,38?,40?,41?,42?,45?,47?,49?,50?,51?,52?/m0/s1 |
| InChIKey | PYIJHDLJCQJQAZ-KHSKIJPYSA-N |
| XLogP | 12.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.16 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|