C16H28O — CID 70887584
(4aS,8aS)-2,4a,7-trimethyl-8a-propan-2-yloxy-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 70887584) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (4aS,8aS)-2,4a,7-trimethyl-8a-propan-2-yloxy-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | (4aS,8aS)-2,4a,7-trimethyl-8a-propan-2-yloxy-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 70887584 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (4aS,8aS)-2,4a,7-trimethyl-8a-propan-2-yloxy-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | CC1=C[C@@]2(OC(C)C)CC(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C16H28O/c1-12(2)17-16-10-13(3)6-8-15(16,5)9-7-14(4)11-16/h10,12,14H,6-9,11H2,1-5H3/t14?,15-,16-/m1/s1 |
| InChIKey | ZOVBRZOSPWXHLQ-ANGDWKNPSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|