About 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran
3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran (PubChem CID 70888591) has the molecular formula C11H16S2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran.
Molecular Properties
| Compound Name | 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran |
| PubChem CID | 70888591 |
| Molecular Formula | C11H16S2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran |
| SMILES | Cc1c(C(C)C)sc2c1CCSC2 |
| InChI | InChI=1S/C11H16S2/c1-7(2)11-8(3)9-4-5-12-6-10(9)13-11/h7H,4-6H2,1-3H3 |
| InChIKey | XBHOUCLDVNOJGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran?
The IUPAC name of 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran (CID 70888591) is 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran.
What is the SMILES notation for 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran?
The canonical SMILES for 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran is Cc1c(C(C)C)sc2c1CCSC2.
What is the InChIKey of 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran?
The InChIKey is XBHOUCLDVNOJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16S2/c1-7(2)11-8(3)9-4-5-12-6-10(9)13-11/h7H,4-6H2,1-3H3.
What are the key properties of 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran?
3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran has a molecular weight of 212.38 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]thiopyran is sourced from PubChem (CID 70888591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).