C25H24FN5O — CID 70888727
N-[3-(3-amino-11-methyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-8-yl)-4-methylphenyl]-3-(fluoromethyl)benzamide (PubChem CID 70888727) has the molecular formula C25H24FN5O and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[3-(3-amino-11-methyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-8-yl)-4-methylphenyl]-3-(fluoromethyl)benzamide.
| Compound Name | N-[3-(3-amino-11-methyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-8-yl)-4-methylphenyl]-3-(fluoromethyl)benzamide |
|---|---|
| PubChem CID | 70888727 |
| Molecular Formula | C25H24FN5O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[3-(3-amino-11-methyl-4,5,7-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraen-8-yl)-4-methylphenyl]-3-(fluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(CF)c2)cc1-c1nc2n[nH]c(N)c2c2c1CC(C)C2 |
| InChI | InChI=1S/C25H24FN5O/c1-13-8-19-20(9-13)22(29-24-21(19)23(27)30-31-24)18-11-17(7-6-14(18)2)28-25(32)16-5-3-4-15(10-16)12-26/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,28,32)(H3,27,29,30,31) |
| InChIKey | BNGWRPYLFBTXEX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |