C20H28NO+ — CID 70889060
3-[1-[2-(4-butylphenyl)ethyl]pyridin-1-ium-3-yl]propan-1-ol (PubChem CID 70889060) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-[1-[2-(4-butylphenyl)ethyl]pyridin-1-ium-3-yl]propan-1-ol.
| Compound Name | 3-[1-[2-(4-butylphenyl)ethyl]pyridin-1-ium-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 70889060 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 3-[1-[2-(4-butylphenyl)ethyl]pyridin-1-ium-3-yl]propan-1-ol |
| SMILES | CCCCc1ccc(CC[n+]2cccc(CCCO)c2)cc1 |
| InChI | InChI=1S/C20H28NO/c1-2-3-6-18-9-11-19(12-10-18)13-15-21-14-4-7-20(17-21)8-5-16-22/h4,7,9-12,14,17,22H,2-3,5-6,8,13,15-16H2,1H3/q+1 |
| InChIKey | GTZCIJWPNUCZBS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|