C20H24ClNO2 — CID 70889092
(2S,3R,4S)-4-[[4-(4-chlorophenyl)phenyl]methylamino]-2,4-dimethyloxan-3-ol (PubChem CID 70889092) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is (2S,3R,4S)-4-[[4-(4-chlorophenyl)phenyl]methylamino]-2,4-dimethyloxan-3-ol.
| Compound Name | (2S,3R,4S)-4-[[4-(4-chlorophenyl)phenyl]methylamino]-2,4-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 70889092 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (2S,3R,4S)-4-[[4-(4-chlorophenyl)phenyl]methylamino]-2,4-dimethyloxan-3-ol |
| SMILES | C[C@@H]1OCC[C@](C)(NCc2ccc(-c3ccc(Cl)cc3)cc2)[C@H]1O |
| InChI | InChI=1S/C20H24ClNO2/c1-14-19(23)20(2,11-12-24-14)22-13-15-3-5-16(6-4-15)17-7-9-18(21)10-8-17/h3-10,14,19,22-23H,11-13H2,1-2H3/t14-,19-,20-/m0/s1 |
| InChIKey | IMQBXZSCNIQHTF-GKCIPKSASA-N |
| XLogP | 4.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |