C24H34N2O2 — CID 70889148
(2S)-1-methyl-3'-(oxan-4-ylamino)-7-phenylspiro[1,5,6,7,8,8a-hexahydroindolizine-2,1'-cyclopentane]-3-one (PubChem CID 70889148) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (2S)-1-methyl-3'-(oxan-4-ylamino)-7-phenylspiro[1,5,6,7,8,8a-hexahydroindolizine-2,1'-cyclopentane]-3-one.
| Compound Name | (2S)-1-methyl-3'-(oxan-4-ylamino)-7-phenylspiro[1,5,6,7,8,8a-hexahydroindolizine-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 70889148 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | (2S)-1-methyl-3'-(oxan-4-ylamino)-7-phenylspiro[1,5,6,7,8,8a-hexahydroindolizine-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2CC(c3ccccc3)CCN2C(=O)[C@]12CCC(NC1CCOCC1)C2 |
| InChI | InChI=1S/C24H34N2O2/c1-17-22-15-19(18-5-3-2-4-6-18)8-12-26(22)23(27)24(17)11-7-21(16-24)25-20-9-13-28-14-10-20/h2-6,17,19-22,25H,7-16H2,1H3/t17?,19?,21?,22?,24-/m0/s1 |
| InChIKey | REPDJFMUCBPCMC-NMWDGLMHSA-N |
| XLogP | 3.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |