C26H31N5O3 — CID 70890267
2-[(2-cyclohexa-1,3-dien-1-yl-7-oxo-3a,4-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methoxy]-N-cyclohexyl-N-methylbenzamide (PubChem CID 70890267) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[(2-cyclohexa-1,3-dien-1-yl-7-oxo-3a,4-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methoxy]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 2-[(2-cyclohexa-1,3-dien-1-yl-7-oxo-3a,4-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methoxy]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 70890267 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-[(2-cyclohexa-1,3-dien-1-yl-7-oxo-3a,4-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)methoxy]-N-cyclohexyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1OCC1=CC(=O)N2NC(C3=CC=CCC3)=NC2N1)C1CCCCC1 |
| InChI | InChI=1S/C26H31N5O3/c1-30(20-12-6-3-7-13-20)25(33)21-14-8-9-15-22(21)34-17-19-16-23(32)31-26(27-19)28-24(29-31)18-10-4-2-5-11-18/h2,4,8-10,14-16,20,26-27H,3,5-7,11-13,17H2,1H3,(H,28,29) |
| InChIKey | OPMDUNPCBGQLRU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |