C19H25N3O4 — CID 70890769
tert-butyl N-[1-[cyano-[(4-ethoxybenzoyl)amino]methyl]cyclopropyl]carbamate (PubChem CID 70890769) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is tert-butyl N-[1-[cyano-[(4-ethoxybenzoyl)amino]methyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[cyano-[(4-ethoxybenzoyl)amino]methyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 70890769 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | tert-butyl N-[1-[cyano-[(4-ethoxybenzoyl)amino]methyl]cyclopropyl]carbamate |
| SMILES | CCOc1ccc(C(=O)NC(C#N)C2(NC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-5-25-14-8-6-13(7-9-14)16(23)21-15(12-20)19(10-11-19)22-17(24)26-18(2,3)4/h6-9,15H,5,10-11H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | FVINQEHRGPGLOY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |