C26H32N4O3S — CID 70890917
3-(3-ethylsulfonylphenyl)-12-methyl-6-[(1-methylpiperidin-4-yl)methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),3,5,10,12-pentaene (PubChem CID 70890917) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is 3-(3-ethylsulfonylphenyl)-12-methyl-6-[(1-methylpiperidin-4-yl)methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),3,5,10,12-pentaene.
| Compound Name | 3-(3-ethylsulfonylphenyl)-12-methyl-6-[(1-methylpiperidin-4-yl)methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),3,5,10,12-pentaene |
|---|---|
| PubChem CID | 70890917 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-(3-ethylsulfonylphenyl)-12-methyl-6-[(1-methylpiperidin-4-yl)methoxy]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),3,5,10,12-pentaene |
| SMILES | CCS(=O)(=O)c1cccc(C2=CN=C(OCC3CCN(C)CC3)C3Nc4ncc(C)cc4C23)c1 |
| InChI | InChI=1S/C26H32N4O3S/c1-4-34(31,32)20-7-5-6-19(13-20)22-15-28-26(33-16-18-8-10-30(3)11-9-18)24-23(22)21-12-17(2)14-27-25(21)29-24/h5-7,12-15,18,23-24H,4,8-11,16H2,1-3H3,(H,27,29) |
| InChIKey | CKLHZZHYPOPHRI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |