C23H40O3 — CID 70891024
[(1S)-2-[(2R,3R,8R)-2,3,6,6,8-pentamethyl-1,4-dioxaspiro[4.5]decan-8-yl]-1-propylcyclohex-2-en-1-yl]methanol (PubChem CID 70891024) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is [(1S)-2-[(2R,3R,8R)-2,3,6,6,8-pentamethyl-1,4-dioxaspiro[4.5]decan-8-yl]-1-propylcyclohex-2-en-1-yl]methanol.
| Compound Name | [(1S)-2-[(2R,3R,8R)-2,3,6,6,8-pentamethyl-1,4-dioxaspiro[4.5]decan-8-yl]-1-propylcyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 70891024 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | [(1S)-2-[(2R,3R,8R)-2,3,6,6,8-pentamethyl-1,4-dioxaspiro[4.5]decan-8-yl]-1-propylcyclohex-2-en-1-yl]methanol |
| SMILES | CCC[C@]1(CO)CCCC=C1[C@]1(C)CCC2(O[C@H](C)[C@@H](C)O2)C(C)(C)C1 |
| InChI | InChI=1S/C23H40O3/c1-7-11-22(16-24)12-9-8-10-19(22)21(6)13-14-23(20(4,5)15-21)25-17(2)18(3)26-23/h10,17-18,24H,7-9,11-16H2,1-6H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | IXXPWQJWNOMGHY-MCEIDBOGSA-N |
| XLogP | 5.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|