About [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane
[[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane (PubChem CID 70891119) has the molecular formula C11H25N3O2S
and a molecular weight of 263.41 g/mol. Its IUPAC name is [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane.
Molecular Properties
| Compound Name | [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane |
| PubChem CID | 70891119 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane |
| SMILES | CN[C@H](CNS(=O)(=O)N(C)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C11H25N3O2S/c1-11(2,3)10(12-4)8-13-17(15,16)14(5)9-6-7-9/h9-10,12-13H,6-8H2,1-5H3/t10-/m1/s1 |
| InChIKey | PEYFAFLWNDCVEM-SNVBAGLBSA-N |
| XLogP | 0.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane?
The IUPAC name of [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane (CID 70891119) is [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane.
What is the SMILES notation for [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane?
The canonical SMILES for [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane is CN[C@H](CNS(=O)(=O)N(C)C1CC1)C(C)(C)C.
What is the InChIKey of [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane?
The InChIKey is PEYFAFLWNDCVEM-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H25N3O2S/c1-11(2,3)10(12-4)8-13-17(15,16)14(5)9-6-7-9/h9-10,12-13H,6-8H2,1-5H3/t10-/m1/s1.
What are the key properties of [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane?
[[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane has a molecular weight of 263.41 g/mol, XLogP of 0.55, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2S)-3,3-dimethyl-2-(methylamino)butyl]sulfamoyl-methylamino]cyclopropane is sourced from PubChem (CID 70891119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).