About 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine
1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine (PubChem CID 70891371) has the molecular formula C19H20ClF3N4O2
and a molecular weight of 428.84 g/mol. Its IUPAC name is 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine.
Molecular Properties
| Compound Name | 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine |
| PubChem CID | 70891371 |
| Molecular Formula | C19H20ClF3N4O2 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine |
| SMILES | FC(F)(F)c1ccc2c(c1)nc(NCCCOC1CCCCO1)c1ncc(Cl)n12 |
| InChI | InChI=1S/C19H20ClF3N4O2/c20-15-11-25-18-17(24-7-3-9-29-16-4-1-2-8-28-16)26-13-10-12(19(21,22)23)5-6-14(13)27(15)18/h5-6,10-11,16H,1-4,7-9H2,(H,24,26) |
| InChIKey | XGORITLQEBOUBN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine?
The IUPAC name of 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine (CID 70891371) is 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine.
What is the SMILES notation for 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine?
The canonical SMILES for 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine is FC(F)(F)c1ccc2c(c1)nc(NCCCOC1CCCCO1)c1ncc(Cl)n12.
What is the InChIKey of 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine?
The InChIKey is XGORITLQEBOUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClF3N4O2/c20-15-11-25-18-17(24-7-3-9-29-16-4-1-2-8-28-16)26-13-10-12(19(21,22)23)5-6-14(13)27(15)18/h5-6,10-11,16H,1-4,7-9H2,(H,24,26).
What are the key properties of 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine?
1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine has a molecular weight of 428.84 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N-[3-(oxan-2-yloxy)propyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-amine is sourced from PubChem (CID 70891371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).