C18H16O3 — CID 70891965
3-[3-[(3R)-3-hydroxycyclohexa-1,5-dien-1-yl]phenyl]benzene-1,2-diol (PubChem CID 70891965) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[3-[(3R)-3-hydroxycyclohexa-1,5-dien-1-yl]phenyl]benzene-1,2-diol.
| Compound Name | 3-[3-[(3R)-3-hydroxycyclohexa-1,5-dien-1-yl]phenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 70891965 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[3-[(3R)-3-hydroxycyclohexa-1,5-dien-1-yl]phenyl]benzene-1,2-diol |
| SMILES | Oc1cccc(-c2cccc(C3=C[C@H](O)CC=C3)c2)c1O |
| InChI | InChI=1S/C18H16O3/c19-15-7-2-5-13(11-15)12-4-1-6-14(10-12)16-8-3-9-17(20)18(16)21/h1-6,8-11,15,19-21H,7H2/t15-/m1/s1 |
| InChIKey | WYNFRCIFNZEYOE-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|