About [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea
[(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea (PubChem CID 7089199) has the molecular formula C15H15N3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea |
| PubChem CID | 7089199 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C15H15N3S/c1-9(17-18-15(16)19)12-8-7-11-6-5-10-3-2-4-13(12)14(10)11/h2-4,7-8H,5-6H2,1H3,(H3,16,18,19)/b17-9+ |
| InChIKey | MLZIUDCSNQWUGM-RQZCQDPDSA-N |
| XLogP | 2.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea?
The IUPAC name of [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea (CID 7089199) is [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea.
What is the SMILES notation for [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea?
The canonical SMILES for [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea is C/C(=N\NC(N)=S)c1ccc2c3c(cccc13)CC2.
What is the InChIKey of [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea?
The InChIKey is MLZIUDCSNQWUGM-RQZCQDPDSA-N. The full InChI is InChI=1S/C15H15N3S/c1-9(17-18-15(16)19)12-8-7-11-6-5-10-3-2-4-13(12)14(10)11/h2-4,7-8H,5-6H2,1H3,(H3,16,18,19)/b17-9+.
What are the key properties of [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea?
[(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea has a molecular weight of 269.37 g/mol, XLogP of 2.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]thiourea is sourced from PubChem (CID 7089199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).