About 8-bromo-1,8-dimethylcyclotetradecan-1-amine
8-bromo-1,8-dimethylcyclotetradecan-1-amine (PubChem CID 70892255) has the molecular formula C16H32BrN
and a molecular weight of 318.34 g/mol. Its IUPAC name is 8-bromo-1,8-dimethylcyclotetradecan-1-amine.
Molecular Properties
| Compound Name | 8-bromo-1,8-dimethylcyclotetradecan-1-amine |
| PubChem CID | 70892255 |
| Molecular Formula | C16H32BrN |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 8-bromo-1,8-dimethylcyclotetradecan-1-amine |
| SMILES | CC1(N)CCCCCCC(C)(Br)CCCCCC1 |
| InChI | InChI=1S/C16H32BrN/c1-15(17)11-7-3-5-9-13-16(2,18)14-10-6-4-8-12-15/h3-14,18H2,1-2H3 |
| InChIKey | HLMRTJVHDKLMMM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-1,8-dimethylcyclotetradecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1,8-dimethylcyclotetradecan-1-amine?
The IUPAC name of 8-bromo-1,8-dimethylcyclotetradecan-1-amine (CID 70892255) is 8-bromo-1,8-dimethylcyclotetradecan-1-amine.
What is the SMILES notation for 8-bromo-1,8-dimethylcyclotetradecan-1-amine?
The canonical SMILES for 8-bromo-1,8-dimethylcyclotetradecan-1-amine is CC1(N)CCCCCCC(C)(Br)CCCCCC1.
What is the InChIKey of 8-bromo-1,8-dimethylcyclotetradecan-1-amine?
The InChIKey is HLMRTJVHDKLMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32BrN/c1-15(17)11-7-3-5-9-13-16(2,18)14-10-6-4-8-12-15/h3-14,18H2,1-2H3.
What are the key properties of 8-bromo-1,8-dimethylcyclotetradecan-1-amine?
8-bromo-1,8-dimethylcyclotetradecan-1-amine has a molecular weight of 318.34 g/mol, XLogP of 5.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1,8-dimethylcyclotetradecan-1-amine is sourced from PubChem (CID 70892255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).