C35H34N4O3 — CID 70892320
4-benzyl-18-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione (PubChem CID 70892320) has the molecular formula C35H34N4O3 and a molecular weight of 558.68 g/mol. Its IUPAC name is 4-benzyl-18-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione.
| Compound Name | 4-benzyl-18-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione |
|---|---|
| PubChem CID | 70892320 |
| Molecular Formula | C35H34N4O3 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 4-benzyl-18-[(dimethylamino)methyl]-17-oxa-4,14,21-triazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione |
| SMILES | CN(C)CC1CCn2cc(c3ccccc32)C2=C(C(=O)N(Cc3ccccc3)C2=O)c2cn(c3ccccc23)CCO1 |
| InChI | InChI=1S/C35H34N4O3/c1-36(2)21-25-16-17-37-22-28(26-12-6-8-14-30(26)37)32-33(35(41)39(34(32)40)20-24-10-4-3-5-11-24)29-23-38(18-19-42-25)31-15-9-7-13-27(29)31/h3-15,22-23,25H,16-21H2,1-2H3 |
| InChIKey | BNOUWXCVDRANIK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|