C46H36N6O5 — CID 70892353
1-[(3S)-3-[2-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]ethoxy]butyl]-3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 70892353) has the molecular formula C46H36N6O5 and a molecular weight of 752.83 g/mol. Its IUPAC name is 1-[(3S)-3-[2-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]ethoxy]butyl]-3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 1-[(3S)-3-[2-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]ethoxy]butyl]-3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70892353 |
| Molecular Formula | C46H36N6O5 |
| Molecular Weight | 752.83 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 1-[(3S)-3-[2-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]ethoxy]butyl]-3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | C[C@@H](CCN1C(=O)C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C1=O)OCCN1C(=O)C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C46H36N6O5/c1-26(18-19-51-43(53)39(31-22-47-35-14-6-2-10-27(31)35)40(44(51)54)32-23-48-36-15-7-3-11-28(32)36)57-21-20-52-45(55)41(33-24-49-37-16-8-4-12-29(33)37)42(46(52)56)34-25-50-38-17-9-5-13-30(34)38/h2-17,22-26,47-50H,18-21H2,1H3/t26-/m0/s1 |
| InChIKey | GKVIVEQGHBPMBX-SANMLTNESA-N |
| XLogP | 7.67 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.83 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|