About (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol
(3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol (PubChem CID 70892384) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol.
Molecular Properties
| Compound Name | (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol |
| PubChem CID | 70892384 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol |
| SMILES | CC(C)N(C(C)C)C(O)C1=CC(N)CC=C1 |
| InChI | InChI=1S/C13H24N2O/c1-9(2)15(10(3)4)13(16)11-6-5-7-12(14)8-11/h5-6,8-10,12-13,16H,7,14H2,1-4H3 |
| InChIKey | YTMSFMWVLRDORU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol?
The IUPAC name of (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol (CID 70892384) is (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol.
What is the SMILES notation for (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol?
The canonical SMILES for (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol is CC(C)N(C(C)C)C(O)C1=CC(N)CC=C1.
What is the InChIKey of (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol?
The InChIKey is YTMSFMWVLRDORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-9(2)15(10(3)4)13(16)11-6-5-7-12(14)8-11/h5-6,8-10,12-13,16H,7,14H2,1-4H3.
What are the key properties of (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol?
(3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol has a molecular weight of 224.35 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclohexa-1,5-dien-1-yl)-[di(propan-2-yl)amino]methanol is sourced from PubChem (CID 70892384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).