About 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid
1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70892409) has the molecular formula C24H20F2N2O4
and a molecular weight of 438.43 g/mol. Its IUPAC name is 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid |
| PubChem CID | 70892409 |
| Molecular Formula | C24H20F2N2O4 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ncccc1-c1ccc(C(=O)N2CCCC2C(=O)O)cc1-c1cccc(F)c1F |
| InChI | InChI=1S/C24H20F2N2O4/c1-32-22-17(6-3-11-27-22)15-10-9-14(23(29)28-12-4-8-20(28)24(30)31)13-18(15)16-5-2-7-19(25)21(16)26/h2-3,5-7,9-11,13,20H,4,8,12H2,1H3,(H,30,31) |
| InChIKey | QDRXEBDWEQIBDJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid?
The IUPAC name of 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid (CID 70892409) is 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid?
The canonical SMILES for 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid is COc1ncccc1-c1ccc(C(=O)N2CCCC2C(=O)O)cc1-c1cccc(F)c1F.
What is the InChIKey of 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid?
The InChIKey is QDRXEBDWEQIBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N2O4/c1-32-22-17(6-3-11-27-22)15-10-9-14(23(29)28-12-4-8-20(28)24(30)31)13-18(15)16-5-2-7-19(25)21(16)26/h2-3,5-7,9-11,13,20H,4,8,12H2,1H3,(H,30,31).
What are the key properties of 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid?
1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid has a molecular weight of 438.43 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,3-difluorophenyl)-4-(2-methoxy-3-pyridinyl)benzoyl]pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 70892409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).