C14H14BNO4S2 — CID 70892488
6-methyl-2-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 70892488) has the molecular formula C14H14BNO4S2 and a molecular weight of 335.22 g/mol. Its IUPAC name is 6-methyl-2-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 70892488 |
| Molecular Formula | C14H14BNO4S2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 6-methyl-2-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1csc(-c2ccc(B3OC(=O)CN(C)CC(=O)O3)s2)c1 |
| InChI | InChI=1S/C14H14BNO4S2/c1-9-5-11(21-8-9)10-3-4-12(22-10)15-19-13(17)6-16(2)7-14(18)20-15/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | CFJIJHVRZAMIOP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|