C9H10BNO5 — CID 70892495
2-(furan-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 70892495) has the molecular formula C9H10BNO5 and a molecular weight of 222.99 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-(furan-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 70892495 |
| Molecular Formula | C9H10BNO5 |
| Molecular Weight | 222.99 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(furan-2-yl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(c2ccco2)OC(=O)C1 |
| InChI | InChI=1S/C9H10BNO5/c1-11-5-8(12)15-10(16-9(13)6-11)7-3-2-4-14-7/h2-4H,5-6H2,1H3 |
| InChIKey | QNZYBMSGFWTQOS-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.99 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|