About 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine
2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine (PubChem CID 70892512) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 70892512 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine |
| SMILES | CCC(C)COC1=C(C)C(N)CC=C1C |
| InChI | InChI=1S/C13H23NO/c1-5-9(2)8-15-13-10(3)6-7-12(14)11(13)4/h6,9,12H,5,7-8,14H2,1-4H3 |
| InChIKey | JSSVXGMVXYYCFU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine (CID 70892512) is 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine is CCC(C)COC1=C(C)C(N)CC=C1C.
What is the InChIKey of 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine?
The InChIKey is JSSVXGMVXYYCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-5-9(2)8-15-13-10(3)6-7-12(14)11(13)4/h6,9,12H,5,7-8,14H2,1-4H3.
What are the key properties of 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine?
2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine has a molecular weight of 209.33 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-(2-methylbutoxy)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 70892512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).