C14H15F5N2O — CID 70892513
4-amino-N-[3,5-difluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohex-2-ene-1-carboxamide (PubChem CID 70892513) has the molecular formula C14H15F5N2O and a molecular weight of 322.28 g/mol. Its IUPAC name is 4-amino-N-[3,5-difluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohex-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[3,5-difluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 70892513 |
| Molecular Formula | C14H15F5N2O |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-amino-N-[3,5-difluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]cyclohex-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)NC2C=C(F)C(C(F)(F)F)=C(F)C2)CC1 |
| InChI | InChI=1S/C14H15F5N2O/c15-10-5-9(6-11(16)12(10)14(17,18)19)21-13(22)7-1-3-8(20)4-2-7/h1,3,5,7-9H,2,4,6,20H2,(H,21,22) |
| InChIKey | DWIOOZVGFRQECI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|