C15H28N2O — CID 70892569
(1R)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,2,3-trimethylcyclohex-2-en-1-amine (PubChem CID 70892569) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,2,3-trimethylcyclohex-2-en-1-amine.
| Compound Name | (1R)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,2,3-trimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 70892569 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (1R)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,2,3-trimethylcyclohex-2-en-1-amine |
| SMILES | CC1=C(C)[C@](C)(N)CCC1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C15H28N2O/c1-10-8-17(9-11(2)18-10)14-6-7-15(5,16)13(4)12(14)3/h10-11,14H,6-9,16H2,1-5H3/t10-,11+,14?,15-/m1/s1 |
| InChIKey | SXURENGSHPWLSC-VOFABYSYSA-N |
| XLogP | 2.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|