C13H24N2 — CID 70892576
4-N-(2,4-dimethylpentyl)cyclohexa-1,3-diene-1,4-diamine (PubChem CID 70892576) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-N-(2,4-dimethylpentyl)cyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 4-N-(2,4-dimethylpentyl)cyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 70892576 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-N-(2,4-dimethylpentyl)cyclohexa-1,3-diene-1,4-diamine |
| SMILES | CC(C)CC(C)CNC1=CC=C(N)CC1 |
| InChI | InChI=1S/C13H24N2/c1-10(2)8-11(3)9-15-13-6-4-12(14)5-7-13/h4,6,10-11,15H,5,7-9,14H2,1-3H3 |
| InChIKey | MKZAEYRZJYSXHZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |