C14H21F3N2O — CID 70892604
5-amino-N-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentanamide (PubChem CID 70892604) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 5-amino-N-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentanamide.
| Compound Name | 5-amino-N-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentanamide |
|---|---|
| PubChem CID | 70892604 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 5-amino-N-[5,6-dimethyl-4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]pentanamide |
| SMILES | CC1=C(C(F)(F)F)C=CC(NC(=O)CCCCN)C1C |
| InChI | InChI=1S/C14H21F3N2O/c1-9-10(2)12(7-6-11(9)14(15,16)17)19-13(20)5-3-4-8-18/h6-7,10,12H,3-5,8,18H2,1-2H3,(H,19,20) |
| InChIKey | YXAZWBIZHBDIQL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|