C16H30N2O — CID 70892615
5-amino-1-[[(E)-1-(cyclohexen-1-yl)pent-3-enyl]amino]pentan-1-ol (PubChem CID 70892615) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 5-amino-1-[[(E)-1-(cyclohexen-1-yl)pent-3-enyl]amino]pentan-1-ol.
| Compound Name | 5-amino-1-[[(E)-1-(cyclohexen-1-yl)pent-3-enyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 70892615 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 5-amino-1-[[(E)-1-(cyclohexen-1-yl)pent-3-enyl]amino]pentan-1-ol |
| SMILES | C/C=C/CC(NC(O)CCCCN)C1=CCCCC1 |
| InChI | InChI=1S/C16H30N2O/c1-2-3-11-15(14-9-5-4-6-10-14)18-16(19)12-7-8-13-17/h2-3,9,15-16,18-19H,4-8,10-13,17H2,1H3/b3-2+ |
| InChIKey | IVADTMYEPZTKPS-NSCUHMNNSA-N |
| XLogP | 2.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|