About (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine
(E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine (PubChem CID 70892623) has the molecular formula C12H23FN2O
and a molecular weight of 230.33 g/mol. Its IUPAC name is (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine.
Molecular Properties
| Compound Name | (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine |
| PubChem CID | 70892623 |
| Molecular Formula | C12H23FN2O |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine |
| SMILES | CC[C@@H](N)/C(F)=C\CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H23FN2O/c1-4-12(14)11(13)5-6-15-7-9(2)16-10(3)8-15/h5,9-10,12H,4,6-8,14H2,1-3H3/b11-5+/t9?,10?,12-/m1/s1 |
| InChIKey | UVYCYGKGEIAESN-XTPCEBTMSA-N |
| XLogP | 1.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine?
The IUPAC name of (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine (CID 70892623) is (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine.
What is the SMILES notation for (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine?
The canonical SMILES for (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine is CC[C@@H](N)/C(F)=C\CN1CC(C)OC(C)C1.
What is the InChIKey of (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine?
The InChIKey is UVYCYGKGEIAESN-XTPCEBTMSA-N. The full InChI is InChI=1S/C12H23FN2O/c1-4-12(14)11(13)5-6-15-7-9(2)16-10(3)8-15/h5,9-10,12H,4,6-8,14H2,1-3H3/b11-5+/t9?,10?,12-/m1/s1.
What are the key properties of (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine?
(E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine has a molecular weight of 230.33 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3R)-6-(2,6-dimethylmorpholin-4-yl)-4-fluorohex-4-en-3-amine is sourced from PubChem (CID 70892623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).