About (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine
(Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine (PubChem CID 70892663) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine.
Molecular Properties
| Compound Name | (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine |
| PubChem CID | 70892663 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine |
| SMILES | CCC(N)/C=C\CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-4-12(13)6-5-7-14-8-10(2)15-11(3)9-14/h5-6,10-12H,4,7-9,13H2,1-3H3/b6-5-/t10-,11+,12? |
| InChIKey | XSGZNFPTKDYYFL-UFFRRDCGSA-N |
| XLogP | 1.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine?
The IUPAC name of (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine (CID 70892663) is (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine.
What is the SMILES notation for (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine?
The canonical SMILES for (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine is CCC(N)/C=C\CN1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine?
The InChIKey is XSGZNFPTKDYYFL-UFFRRDCGSA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-12(13)6-5-7-14-8-10(2)15-11(3)9-14/h5-6,10-12H,4,7-9,13H2,1-3H3/b6-5-/t10-,11+,12?.
What are the key properties of (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine?
(Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine has a molecular weight of 212.34 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hex-4-en-3-amine is sourced from PubChem (CID 70892663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).