C19H24N2O5 — CID 7089319
hexyl (4R)-4-(1,3-benzodioxol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7089319) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is hexyl (4R)-4-(1,3-benzodioxol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | hexyl (4R)-4-(1,3-benzodioxol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7089319 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | hexyl (4R)-4-(1,3-benzodioxol-5-yl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCCCOC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H24N2O5/c1-3-4-5-6-9-24-18(22)16-12(2)20-19(23)21-17(16)13-7-8-14-15(10-13)26-11-25-14/h7-8,10,17H,3-6,9,11H2,1-2H3,(H2,20,21,23)/t17-/m1/s1 |
| InChIKey | RMCCHQXRIICHCN-QGZVFWFLSA-N |
| XLogP | 3.17 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|