C12H19BN2O3 — CID 70893298
[(2R)-1-[(1R,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronic acid (PubChem CID 70893298) has the molecular formula C12H19BN2O3 and a molecular weight of 250.11 g/mol. Its IUPAC name is [(2R)-1-[(1R,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronic acid.
| Compound Name | [(2R)-1-[(1R,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronic acid |
|---|---|
| PubChem CID | 70893298 |
| Molecular Formula | C12H19BN2O3 |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [(2R)-1-[(1R,3R,4S)-3-aminobicyclo[2.2.1]hept-5-ene-2-carbonyl]pyrrolidin-2-yl]boronic acid |
| SMILES | N[C@H]1C(C(=O)N2CCC[C@H]2B(O)O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H19BN2O3/c14-11-8-4-3-7(6-8)10(11)12(16)15-5-1-2-9(15)13(17)18/h3-4,7-11,17-18H,1-2,5-6,14H2/t7-,8+,9-,10?,11+/m0/s1 |
| InChIKey | CALQLUWXHWBBHP-SQVYSQSISA-N |
| XLogP | -0.86 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|