C22H28ClN3O4S2 — CID 70893677
(5-chlorothiophen-2-yl) N-[(3R,5S)-1-(6,8-dimethyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)-5-(methoxymethyl)pyrrolidin-3-yl]carbamate (PubChem CID 70893677) has the molecular formula C22H28ClN3O4S2 and a molecular weight of 498.07 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl) N-[(3R,5S)-1-(6,8-dimethyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)-5-(methoxymethyl)pyrrolidin-3-yl]carbamate.
| Compound Name | (5-chlorothiophen-2-yl) N-[(3R,5S)-1-(6,8-dimethyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)-5-(methoxymethyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70893677 |
| Molecular Formula | C22H28ClN3O4S2 |
| Molecular Weight | 498.07 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | (5-chlorothiophen-2-yl) N-[(3R,5S)-1-(6,8-dimethyl-4,5,7,8-tetrahydrothieno[2,3-d]azepine-2-carbonyl)-5-(methoxymethyl)pyrrolidin-3-yl]carbamate |
| SMILES | COC[C@@H]1C[C@@H](NC(=O)Oc2ccc(Cl)s2)CN1C(=O)c1cc2c(s1)C(C)CN(C)CC2 |
| InChI | InChI=1S/C22H28ClN3O4S2/c1-13-10-25(2)7-6-14-8-17(31-20(13)14)21(27)26-11-15(9-16(26)12-29-3)24-22(28)30-19-5-4-18(23)32-19/h4-5,8,13,15-16H,6-7,9-12H2,1-3H3,(H,24,28)/t13?,15-,16+/m1/s1 |
| InChIKey | PWLVPLMNDLKIKF-CZVYVAOFSA-N |
| XLogP | 4.07 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.07 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |