C15H17N3 — CID 70893950
N-ethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine (PubChem CID 70893950) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N-ethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-ethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 70893950 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-ethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
| SMILES | CCNc1ncc2c(n1)-c1ccccc1CCC2 |
| InChI | InChI=1S/C15H17N3/c1-2-16-15-17-10-12-8-5-7-11-6-3-4-9-13(11)14(12)18-15/h3-4,6,9-10H,2,5,7-8H2,1H3,(H,16,17,18) |
| InChIKey | GFPVZNOGUMGGQW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |