C23H39O3S- — CID 70894098
(4E,8E)-10-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)dodeca-4,8-diene-3-sulfinate (PubChem CID 70894098) has the molecular formula C23H39O3S- and a molecular weight of 395.63 g/mol. Its IUPAC name is (4E,8E)-10-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)dodeca-4,8-diene-3-sulfinate.
| Compound Name | (4E,8E)-10-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)dodeca-4,8-diene-3-sulfinate |
|---|---|
| PubChem CID | 70894098 |
| Molecular Formula | C23H39O3S- |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (4E,8E)-10-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)dodeca-4,8-diene-3-sulfinate |
| SMILES | CCC(/C=C(\C)CC/C=C(\C)C(O)C(C)C1=C(C)CCCC1(C)C)S(=O)[O-] |
| InChI | InChI=1S/C23H40O3S/c1-8-20(27(25)26)15-16(2)11-9-12-18(4)22(24)19(5)21-17(3)13-10-14-23(21,6)7/h12,15,19-20,22,24H,8-11,13-14H2,1-7H3,(H,25,26)/p-1/b16-15+,18-12+ |
| InChIKey | AGYXDXQSGJROKM-BPRCWXEDSA-M |
| XLogP | 5.84 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|