About 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine
4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine (PubChem CID 70894676) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine.
Molecular Properties
| Compound Name | 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine |
| PubChem CID | 70894676 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine |
| SMILES | CCC1=CC(CC(C)CC(C)C)CCN=C1C |
| InChI | InChI=1S/C16H29N/c1-6-16-11-15(7-8-17-14(16)5)10-13(4)9-12(2)3/h11-13,15H,6-10H2,1-5H3 |
| InChIKey | POXKOXMALBJLBU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine?
The IUPAC name of 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine (CID 70894676) is 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine.
What is the SMILES notation for 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine?
The canonical SMILES for 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine is CCC1=CC(CC(C)CC(C)C)CCN=C1C.
What is the InChIKey of 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine?
The InChIKey is POXKOXMALBJLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N/c1-6-16-11-15(7-8-17-14(16)5)10-13(4)9-12(2)3/h11-13,15H,6-10H2,1-5H3.
What are the key properties of 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine?
4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine has a molecular weight of 235.41 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylpentyl)-6-ethyl-7-methyl-3,4-dihydro-2H-azepine is sourced from PubChem (CID 70894676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).