C16H27BN2O3 — CID 70894744
2-amino-1-[(2R)-2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone (PubChem CID 70894744) has the molecular formula C16H27BN2O3 and a molecular weight of 306.22 g/mol. Its IUPAC name is 2-amino-1-[(2R)-2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[(2R)-2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70894744 |
| Molecular Formula | C16H27BN2O3 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-amino-1-[(2R)-2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC1(C)C2C[C@H]1C[C@H]1OB([C@@H]3CCCN3C(=O)CN)O[C@@]21C |
| InChI | InChI=1S/C16H27BN2O3/c1-15(2)10-7-11(15)16(3)12(8-10)21-17(22-16)13-5-4-6-19(13)14(20)9-18/h10-13H,4-9,18H2,1-3H3/t10-,11?,12+,13-,16-/m0/s1 |
| InChIKey | RHHQGVRTPMFXNX-CIDJJEECSA-N |
| XLogP | 1.20 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|