C25H26O — CID 70894853
2-(2-methoxy-3-propan-2-ylphenyl)-9,9-dimethylfluorene (PubChem CID 70894853) has the molecular formula C25H26O and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-(2-methoxy-3-propan-2-ylphenyl)-9,9-dimethylfluorene.
| Compound Name | 2-(2-methoxy-3-propan-2-ylphenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 70894853 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-(2-methoxy-3-propan-2-ylphenyl)-9,9-dimethylfluorene |
| SMILES | COc1c(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cccc1C(C)C |
| InChI | InChI=1S/C25H26O/c1-16(2)18-10-8-11-19(24(18)26-5)17-13-14-21-20-9-6-7-12-22(20)25(3,4)23(21)15-17/h6-16H,1-5H3 |
| InChIKey | FMLZVPYRNYSYRW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |