C30H36N2O6 — CID 70895135
methyl (2R,4S,7S)-7-tert-butyl-2-methoxy-6,9-dioxo-16-phenyl-10-oxa-5,8-diazatricyclo[13.3.1.12,5]icosa-1(19),13,15,17-tetraene-4-carboxylate (PubChem CID 70895135) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is methyl (2R,4S,7S)-7-tert-butyl-2-methoxy-6,9-dioxo-16-phenyl-10-oxa-5,8-diazatricyclo[13.3.1.12,5]icosa-1(19),13,15,17-tetraene-4-carboxylate.
| Compound Name | methyl (2R,4S,7S)-7-tert-butyl-2-methoxy-6,9-dioxo-16-phenyl-10-oxa-5,8-diazatricyclo[13.3.1.12,5]icosa-1(19),13,15,17-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 70895135 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | methyl (2R,4S,7S)-7-tert-butyl-2-methoxy-6,9-dioxo-16-phenyl-10-oxa-5,8-diazatricyclo[13.3.1.12,5]icosa-1(19),13,15,17-tetraene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(OC)CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCC=Cc1cc2ccc1-c1ccccc1 |
| InChI | InChI=1S/C30H36N2O6/c1-29(2,3)25-26(33)32-19-30(37-5,18-24(32)27(34)36-4)22-14-15-23(20-11-7-6-8-12-20)21(17-22)13-9-10-16-38-28(35)31-25/h6-9,11-15,17,24-25H,10,16,18-19H2,1-5H3,(H,31,35)/t24-,25+,30-/m0/s1 |
| InChIKey | XMPKZFPTCXUTOL-FVXXUCQHSA-N |
| XLogP | 4.53 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |