C16H30O6Si — CID 70895156
1-[(3aR,5S,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone (PubChem CID 70895156) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(3aR,5S,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone.
| Compound Name | 1-[(3aR,5S,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone |
|---|---|
| PubChem CID | 70895156 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(3aR,5S,6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanone |
| SMILES | CO[C@H]1C2OC(C)(C)O[C@H]2O[C@@H]1C(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O6Si/c1-15(2,3)23(7,8)19-9-10(17)11-12(18-6)13-14(20-11)22-16(4,5)21-13/h11-14H,9H2,1-8H3/t11-,12-,13?,14-/m1/s1 |
| InChIKey | JQHBRQNVBLEVPU-MVWAYNQESA-N |
| XLogP | 2.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|